(1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate

C13H13NO4 — CID 164850701

IUPAC(1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate
SMILESCC(C)C(=O)OCN1C(=O)c2ccccc2C1=O
InChIInChI=1S/C13H13NO4/c1-8(2)13(17)18-7-14-11(15)9-5-3-4-6-10(9)12(14)16/h3-6,8H,7H2,1-2H3
InChIKeyRJLQUNMAIMNIFO-UHFFFAOYSA-N
MW247.25 g/mol
LogP1.44
Rot. Bonds3

About (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate

(1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate (PubChem CID 164850701) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate.

Molecular Properties

Compound Name(1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate
PubChem CID164850701
Molecular FormulaC13H13NO4
Molecular Weight247.25 g/mol
Exact Mass247.08
IUPAC Name(1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate
SMILESCC(C)C(=O)OCN1C(=O)c2ccccc2C1=O
InChIInChI=1S/C13H13NO4/c1-8(2)13(17)18-7-14-11(15)9-5-3-4-6-10(9)12(14)16/h3-6,8H,7H2,1-2H3
InChIKeyRJLQUNMAIMNIFO-UHFFFAOYSA-N
XLogP1.44
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.25
LogP ≤ 51.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate?
The IUPAC name of (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate (CID 164850701) is (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate is CC(C)C(=O)OCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate?
The InChIKey is RJLQUNMAIMNIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c1-8(2)13(17)18-7-14-11(15)9-5-3-4-6-10(9)12(14)16/h3-6,8H,7H2,1-2H3.
What are the key properties of (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate?
(1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate has a molecular weight of 247.25 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl)methyl 2-methylpropanoate is sourced from PubChem (CID 164850701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).