C17H14N2O4 — CID 16596143
(1,3-dioxoisoindol-2-yl)methyl 2-(methylamino)benzoate (PubChem CID 16596143) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(methylamino)benzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 16596143 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N2O4/c1-18-14-9-5-4-8-13(14)17(22)23-10-19-15(20)11-6-2-3-7-12(11)16(19)21/h2-9,18H,10H2,1H3 |
| InChIKey | ZWQQUYBIGJYIKO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|