C16H10F2N2O4S — CID 8895632
(1,3-dioxoisoindol-2-yl)methyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate (PubChem CID 8895632) has the molecular formula C16H10F2N2O4S and a molecular weight of 364.33 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 8895632 |
| Molecular Formula | C16H10F2N2O4S |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C16H10F2N2O4S/c17-16(18)25-12-11(6-3-7-19-12)15(23)24-8-20-13(21)9-4-1-2-5-10(9)14(20)22/h1-7,16H,8H2 |
| InChIKey | XQDYVVNBIFCUMO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|