C10H11F2NO2S — CID 55475285
propan-2-yl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate (PubChem CID 55475285) has the molecular formula C10H11F2NO2S and a molecular weight of 247.27 g/mol. Its IUPAC name is propan-2-yl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55475285 |
| Molecular Formula | C10H11F2NO2S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | propan-2-yl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
| SMILES | CC(C)OC(=O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C10H11F2NO2S/c1-6(2)15-9(14)7-4-3-5-13-8(7)16-10(11)12/h3-6,10H,1-2H3 |
| InChIKey | PTJDXKFJKRKMJK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |