C16H12ClF2NO3S — CID 55377683
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-(difluoromethylsulfanyl)pyridine-3-carboxylate (PubChem CID 55377683) has the molecular formula C16H12ClF2NO3S and a molecular weight of 371.79 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-(difluoromethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55377683 |
| Molecular Formula | C16H12ClF2NO3S |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1cccnc1SC(F)F)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClF2NO3S/c1-9(13(21)10-4-6-11(17)7-5-10)23-15(22)12-3-2-8-20-14(12)24-16(18)19/h2-9,16H,1H3 |
| InChIKey | SQMPQKJOCUIJPD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |