C14H16F2N2O4S — CID 55377667
(1-morpholin-4-yl-1-oxopropan-2-yl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate (PubChem CID 55377667) has the molecular formula C14H16F2N2O4S and a molecular weight of 346.36 g/mol. Its IUPAC name is (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55377667 |
| Molecular Formula | C14H16F2N2O4S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (1-morpholin-4-yl-1-oxopropan-2-yl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1cccnc1SC(F)F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H16F2N2O4S/c1-9(12(19)18-5-7-21-8-6-18)22-13(20)10-3-2-4-17-11(10)23-14(15)16/h2-4,9,14H,5-8H2,1H3 |
| InChIKey | HOQXIOUBDDHDBO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |