C20H21ClN2O4S — CID 15995957
(2-chlorophenyl) 2-(1-morpholin-4-yl-1-oxobutan-2-yl)sulfanylpyridine-3-carboxylate (PubChem CID 15995957) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is (2-chlorophenyl) 2-(1-morpholin-4-yl-1-oxobutan-2-yl)sulfanylpyridine-3-carboxylate.
| Compound Name | (2-chlorophenyl) 2-(1-morpholin-4-yl-1-oxobutan-2-yl)sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 15995957 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (2-chlorophenyl) 2-(1-morpholin-4-yl-1-oxobutan-2-yl)sulfanylpyridine-3-carboxylate |
| SMILES | CCC(Sc1ncccc1C(=O)Oc1ccccc1Cl)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-2-17(19(24)23-10-12-26-13-11-23)28-18-14(6-5-9-22-18)20(25)27-16-8-4-3-7-15(16)21/h3-9,17H,2,10-13H2,1H3 |
| InChIKey | VUHHSRIQIRQFRA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|