C24H27ClN2O4 — CID 50846409
[2-[[1-(2-chlorobenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone (PubChem CID 50846409) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is [2-[[1-(2-chlorobenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-[[1-(2-chlorobenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 50846409 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [2-[[1-(2-chlorobenzoyl)piperidin-4-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC(COc2ccccc2C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C24H27ClN2O4/c25-21-7-3-1-5-19(21)23(28)26-11-9-18(10-12-26)17-31-22-8-4-2-6-20(22)24(29)27-13-15-30-16-14-27/h1-8,18H,9-17H2 |
| InChIKey | YQXSCSRCTYDRLC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |