C19H28N2O2 — CID 119646664
[2-(cyclopropylmethoxy)phenyl]-[4-(ethylaminomethyl)piperidin-1-yl]methanone (PubChem CID 119646664) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [2-(cyclopropylmethoxy)phenyl]-[4-(ethylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | [2-(cyclopropylmethoxy)phenyl]-[4-(ethylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119646664 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [2-(cyclopropylmethoxy)phenyl]-[4-(ethylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CCNCC1CCN(C(=O)c2ccccc2OCC2CC2)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-2-20-13-15-9-11-21(12-10-15)19(22)17-5-3-4-6-18(17)23-14-16-7-8-16/h3-6,15-16,20H,2,7-14H2,1H3 |
| InChIKey | YOYCGGCLKJVKNT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |