C10H9NO4S-2 — CID 7476918
2-[(1R)-1-carboxylatopropyl]sulfanylpyridine-3-carboxylate (PubChem CID 7476918) has the molecular formula C10H9NO4S-2 and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-[(1R)-1-carboxylatopropyl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[(1R)-1-carboxylatopropyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 7476918 |
| Molecular Formula | C10H9NO4S-2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-[(1R)-1-carboxylatopropyl]sulfanylpyridine-3-carboxylate |
| SMILES | CC[C@@H](Sc1ncccc1C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H11NO4S/c1-2-7(10(14)15)16-8-6(9(12)13)4-3-5-11-8/h3-5,7H,2H2,1H3,(H,12,13)(H,14,15)/p-2/t7-/m1/s1 |
| InChIKey | BDUZHLLXDWNLSX-SSDOTTSWSA-L |
| XLogP | -0.93 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |