C11H10NO2S2- — CID 6927172
(2S)-2-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 6927172) has the molecular formula C11H10NO2S2- and a molecular weight of 252.34 g/mol. Its IUPAC name is (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
| Compound Name | (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 6927172 |
| Molecular Formula | C11H10NO2S2- |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | (2S)-2-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | CC[C@H](Sc1nc2ccccc2s1)C(=O)[O-] |
| InChI | InChI=1S/C11H11NO2S2/c1-2-8(10(13)14)15-11-12-7-5-3-4-6-9(7)16-11/h3-6,8H,2H2,1H3,(H,13,14)/p-1/t8-/m0/s1 |
| InChIKey | QYKKOQIKRSOKTR-QMMMGPOBSA-M |
| XLogP | 1.92 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |