C20H21N3OS2 — CID 129441301
(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)-N-(1-phenylpropan-2-ylideneamino)butanamide (PubChem CID 129441301) has the molecular formula C20H21N3OS2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-ylsulfanyl)-N-(1-phenylpropan-2-ylideneamino)butanamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-ylsulfanyl)-N-(1-phenylpropan-2-ylideneamino)butanamide |
|---|---|
| PubChem CID | 129441301 |
| Molecular Formula | C20H21N3OS2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-ylsulfanyl)-N-(1-phenylpropan-2-ylideneamino)butanamide |
| SMILES | CC[C@@H](Sc1nc2ccccc2s1)C(=O)NN=C(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H21N3OS2/c1-3-17(25-20-21-16-11-7-8-12-18(16)26-20)19(24)23-22-14(2)13-15-9-5-4-6-10-15/h4-12,17H,3,13H2,1-2H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | YSDQXIAPENIFPB-QGZVFWFLSA-N |
| XLogP | 4.90 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|