C21H21N3OS2 — CID 6006342
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide (PubChem CID 6006342) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide |
|---|---|
| PubChem CID | 6006342 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]butanamide |
| SMILES | CCC(Sc1nc2ccccc2s1)C(=O)N/N=C(C)\C=C\c1ccccc1 |
| InChI | InChI=1S/C21H21N3OS2/c1-3-18(26-21-22-17-11-7-8-12-19(17)27-21)20(25)24-23-15(2)13-14-16-9-5-4-6-10-16/h4-14,18H,3H2,1-2H3,(H,24,25)/b14-13+,23-15- |
| InChIKey | MTRYHVBRSOHNQA-XRILBYCGSA-N |
| XLogP | 5.37 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|