C11H9NO4S2 — CID 29417264
(2R)-2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid (PubChem CID 29417264) has the molecular formula C11H9NO4S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid |
|---|---|
| PubChem CID | 29417264 |
| Molecular Formula | C11H9NO4S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid |
| SMILES | O=C(O)C[C@@H](Sc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C11H9NO4S2/c13-9(14)5-8(10(15)16)18-11-12-6-3-1-2-4-7(6)17-11/h1-4,8H,5H2,(H,13,14)(H,15,16)/t8-/m1/s1 |
| InChIKey | KRDSXENYLDIORL-MRVPVSSYSA-N |
| XLogP | 2.32 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |