2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid

C13H13NO5S2 — CID 19772384

IUPAC2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid
SMILESCCOc1ccc2nc(SC(CC(=O)O)C(=O)O)sc2c1
InChIInChI=1S/C13H13NO5S2/c1-2-19-7-3-4-8-9(5-7)20-13(14-8)21-10(12(17)18)6-11(15)16/h3-5,10H,2,6H2,1H3,(H,15,16)(H,17,18)
InChIKeyNPBUQLWIAGSRMX-UHFFFAOYSA-N
MW327.38 g/mol
LogP2.71
Rot. Bonds7

About 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid

2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (PubChem CID 19772384) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.

Molecular Properties

Compound Name2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid
PubChem CID19772384
Molecular FormulaC13H13NO5S2
Molecular Weight327.38 g/mol
Exact Mass327.02
IUPAC Name2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid
SMILESCCOc1ccc2nc(SC(CC(=O)O)C(=O)O)sc2c1
InChIInChI=1S/C13H13NO5S2/c1-2-19-7-3-4-8-9(5-7)20-13(14-8)21-10(12(17)18)6-11(15)16/h3-5,10H,2,6H2,1H3,(H,15,16)(H,17,18)
InChIKeyNPBUQLWIAGSRMX-UHFFFAOYSA-N
XLogP2.71
TPSA96.72 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.38
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
The IUPAC name of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (CID 19772384) is 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.
What is the SMILES notation for 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
The canonical SMILES for 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid is CCOc1ccc2nc(SC(CC(=O)O)C(=O)O)sc2c1.
What is the InChIKey of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
The InChIKey is NPBUQLWIAGSRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5S2/c1-2-19-7-3-4-8-9(5-7)20-13(14-8)21-10(12(17)18)6-11(15)16/h3-5,10H,2,6H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid has a molecular weight of 327.38 g/mol, XLogP of 2.71, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid is sourced from PubChem (CID 19772384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).