C14H13NO6S2 — CID 67822349
2-[(5-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (PubChem CID 67822349) has the molecular formula C14H13NO6S2 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[(5-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.
| Compound Name | 2-[(5-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 67822349 |
| Molecular Formula | C14H13NO6S2 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-[(5-ethoxycarbonyl-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid |
| SMILES | CCOC(=O)c1ccc2sc(SC(CC(=O)O)C(=O)O)nc2c1 |
| InChI | InChI=1S/C14H13NO6S2/c1-2-21-13(20)7-3-4-9-8(5-7)15-14(22-9)23-10(12(18)19)6-11(16)17/h3-5,10H,2,6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | UHOWHEBUZCUWGX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |