C12H11NO4S2 — CID 70435768
ethyl 2-acetyloxysulfanyl-1,3-benzothiazole-5-carboxylate (PubChem CID 70435768) has the molecular formula C12H11NO4S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 2-acetyloxysulfanyl-1,3-benzothiazole-5-carboxylate.
| Compound Name | ethyl 2-acetyloxysulfanyl-1,3-benzothiazole-5-carboxylate |
|---|---|
| PubChem CID | 70435768 |
| Molecular Formula | C12H11NO4S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | ethyl 2-acetyloxysulfanyl-1,3-benzothiazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2sc(SOC(C)=O)nc2c1 |
| InChI | InChI=1S/C12H11NO4S2/c1-3-16-11(15)8-4-5-10-9(6-8)13-12(18-10)19-17-7(2)14/h4-6H,3H2,1-2H3 |
| InChIKey | LHGSXJJYGFZROX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|