About ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate
ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate (PubChem CID 153065522) has the molecular formula C14H14N4O3S2
and a molecular weight of 350.43 g/mol. Its IUPAC name is ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate |
| PubChem CID | 153065522 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1Sc1nc2cc(OCC)ccc2s1 |
| InChI | InChI=1S/C14H14N4O3S2/c1-3-20-8-5-6-10-9(7-8)15-14(22-10)23-12-11(16-18-17-12)13(19)21-4-2/h5-7H,3-4H2,1-2H3,(H,16,17,18) |
| InChIKey | VKHICOQOMVQHTM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate?
The IUPAC name of ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate (CID 153065522) is ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate is CCOC(=O)c1n[nH]nc1Sc1nc2cc(OCC)ccc2s1.
What is the InChIKey of ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate?
The InChIKey is VKHICOQOMVQHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O3S2/c1-3-20-8-5-6-10-9(7-8)15-14(22-10)23-12-11(16-18-17-12)13(19)21-4-2/h5-7H,3-4H2,1-2H3,(H,16,17,18).
What are the key properties of ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate?
ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate has a molecular weight of 350.43 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(5-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]-2H-triazole-4-carboxylate is sourced from PubChem (CID 153065522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).