C11H9Cl2N3O2S — CID 149339072
ethyl 5-(3,4-dichlorophenyl)sulfanyl-2H-triazole-4-carboxylate (PubChem CID 149339072) has the molecular formula C11H9Cl2N3O2S and a molecular weight of 318.19 g/mol. Its IUPAC name is ethyl 5-(3,4-dichlorophenyl)sulfanyl-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(3,4-dichlorophenyl)sulfanyl-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 149339072 |
| Molecular Formula | C11H9Cl2N3O2S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | ethyl 5-(3,4-dichlorophenyl)sulfanyl-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3O2S/c1-2-18-11(17)9-10(15-16-14-9)19-6-3-4-7(12)8(13)5-6/h3-5H,2H2,1H3,(H,14,15,16) |
| InChIKey | YDUZELKLIBSILM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |