C17H14ClN3O2S — CID 169400307
ethyl 5-[2-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxylate (PubChem CID 169400307) has the molecular formula C17H14ClN3O2S and a molecular weight of 359.84 g/mol. Its IUPAC name is ethyl 5-[2-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400307 |
| Molecular Formula | C17H14ClN3O2S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | ethyl 5-[2-(2-chlorophenyl)sulfanylphenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccccc1Sc1ccccc1Cl |
| InChI | InChI=1S/C17H14ClN3O2S/c1-2-23-17(22)16-15(19-21-20-16)11-7-3-5-9-13(11)24-14-10-6-4-8-12(14)18/h3-10H,2H2,1H3,(H,19,20,21) |
| InChIKey | IFQYPYUIBRJZPM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |