C17H23N3O2S — CID 169399543
ethyl 5-(2-hexylsulfanylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169399543) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is ethyl 5-(2-hexylsulfanylphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-hexylsulfanylphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399543 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | ethyl 5-(2-hexylsulfanylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCCCCCSc1ccccc1-c1n[nH]nc1C(=O)OCC |
| InChI | InChI=1S/C17H23N3O2S/c1-3-5-6-9-12-23-14-11-8-7-10-13(14)15-16(19-20-18-15)17(21)22-4-2/h7-8,10-11H,3-6,9,12H2,1-2H3,(H,18,19,20) |
| InChIKey | HAXYJDQEDFMRFE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|