C14H17N3O4 — CID 169399469
ethyl 5-(2-ethoxy-3-methoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169399469) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl 5-(2-ethoxy-3-methoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-ethoxy-3-methoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399469 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | ethyl 5-(2-ethoxy-3-methoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc(OC)c1OCC |
| InChI | InChI=1S/C14H17N3O4/c1-4-20-13-9(7-6-8-10(13)19-3)11-12(16-17-15-11)14(18)21-5-2/h6-8H,4-5H2,1-3H3,(H,15,16,17) |
| InChIKey | JGUIJJHFBHZKRV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |