C12H12IN3O3 — CID 169401473
ethyl 5-(3-iodo-2-methoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401473) has the molecular formula C12H12IN3O3 and a molecular weight of 373.15 g/mol. Its IUPAC name is ethyl 5-(3-iodo-2-methoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(3-iodo-2-methoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401473 |
| Molecular Formula | C12H12IN3O3 |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | ethyl 5-(3-iodo-2-methoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cccc(I)c1OC |
| InChI | InChI=1S/C12H12IN3O3/c1-3-19-12(17)10-9(14-16-15-10)7-5-4-6-8(13)11(7)18-2/h4-6H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | PXFYXJIQAXRJCH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|