C11H10ClN3O2 — CID 118989014
ethyl 5-(2-chlorophenyl)-2H-triazole-4-carboxylate (PubChem CID 118989014) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is ethyl 5-(2-chlorophenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-chlorophenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 118989014 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | ethyl 5-(2-chlorophenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccccc1Cl |
| InChI | InChI=1S/C11H10ClN3O2/c1-2-17-11(16)10-9(13-15-14-10)7-5-3-4-6-8(7)12/h3-6H,2H2,1H3,(H,13,14,15) |
| InChIKey | MHPCFIVXEOJLRY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |