C15H17ClN4O2 — CID 169399959
ethyl 5-(2-chloro-4-pyrrolidin-1-ylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169399959) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is ethyl 5-(2-chloro-4-pyrrolidin-1-ylphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-chloro-4-pyrrolidin-1-ylphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399959 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | ethyl 5-(2-chloro-4-pyrrolidin-1-ylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(N2CCCC2)cc1Cl |
| InChI | InChI=1S/C15H17ClN4O2/c1-2-22-15(21)14-13(17-19-18-14)11-6-5-10(9-12(11)16)20-7-3-4-8-20/h5-6,9H,2-4,7-8H2,1H3,(H,17,18,19) |
| InChIKey | CYECMHJNPPITNM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |