C15H18N4O4 — CID 169400304
ethyl 5-(2-hydroxy-4-morpholin-4-ylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169400304) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is ethyl 5-(2-hydroxy-4-morpholin-4-ylphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-hydroxy-4-morpholin-4-ylphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400304 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | ethyl 5-(2-hydroxy-4-morpholin-4-ylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(N2CCOCC2)cc1O |
| InChI | InChI=1S/C15H18N4O4/c1-2-23-15(21)14-13(16-18-17-14)11-4-3-10(9-12(11)20)19-5-7-22-8-6-19/h3-4,9,20H,2,5-8H2,1H3,(H,16,17,18) |
| InChIKey | RGRJWEZJPLVCBC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |