C12H11F2N3O2 — CID 169401605
ethyl 5-(2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401605) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.24 g/mol. Its IUPAC name is ethyl 5-(2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401605 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | ethyl 5-(2,3-difluoro-4-methylphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C12H11F2N3O2/c1-3-19-12(18)11-10(15-17-16-11)7-5-4-6(2)8(13)9(7)14/h4-5H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | IXCYBNQVDXAXKP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |