C13H10FN3O2S — CID 169401448
ethyl 5-(7-fluoro-1-benzothiophen-6-yl)-2H-triazole-4-carboxylate (PubChem CID 169401448) has the molecular formula C13H10FN3O2S and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl 5-(7-fluoro-1-benzothiophen-6-yl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(7-fluoro-1-benzothiophen-6-yl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401448 |
| Molecular Formula | C13H10FN3O2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | ethyl 5-(7-fluoro-1-benzothiophen-6-yl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc2ccsc2c1F |
| InChI | InChI=1S/C13H10FN3O2S/c1-2-19-13(18)11-10(15-17-16-11)8-4-3-7-5-6-20-12(7)9(8)14/h3-6H,2H2,1H3,(H,15,16,17) |
| InChIKey | FDVBKXVDCVXXCG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |