C12H10Br2FN3O2 — CID 169401838
ethyl 5-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-2H-triazole-4-carboxylate (PubChem CID 169401838) has the molecular formula C12H10Br2FN3O2 and a molecular weight of 407.04 g/mol. Its IUPAC name is ethyl 5-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401838 |
| Molecular Formula | C12H10Br2FN3O2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | ethyl 5-[4-bromo-2-(bromomethyl)-3-fluorophenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(Br)c(F)c1CBr |
| InChI | InChI=1S/C12H10Br2FN3O2/c1-2-20-12(19)11-10(16-18-17-11)6-3-4-8(14)9(15)7(6)5-13/h3-4H,2,5H2,1H3,(H,16,17,18) |
| InChIKey | AIJLHRLBHSABPN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|