C11H9Br2N3O3 — CID 169398985
ethyl 5-(3,5-dibromo-4-hydroxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169398985) has the molecular formula C11H9Br2N3O3 and a molecular weight of 391.02 g/mol. Its IUPAC name is ethyl 5-(3,5-dibromo-4-hydroxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(3,5-dibromo-4-hydroxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169398985 |
| Molecular Formula | C11H9Br2N3O3 |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 388.90 |
| IUPAC Name | ethyl 5-(3,5-dibromo-4-hydroxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C11H9Br2N3O3/c1-2-19-11(18)9-8(14-16-15-9)5-3-6(12)10(17)7(13)4-5/h3-4,17H,2H2,1H3,(H,14,15,16) |
| InChIKey | VQFDVCKIAAWKBI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |