C11H9BrClN3O3 — CID 169401252
ethyl 5-(3-bromo-6-chloro-2-hydroxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401252) has the molecular formula C11H9BrClN3O3 and a molecular weight of 346.57 g/mol. Its IUPAC name is ethyl 5-(3-bromo-6-chloro-2-hydroxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(3-bromo-6-chloro-2-hydroxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401252 |
| Molecular Formula | C11H9BrClN3O3 |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | ethyl 5-(3-bromo-6-chloro-2-hydroxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1c(Cl)ccc(Br)c1O |
| InChI | InChI=1S/C11H9BrClN3O3/c1-2-19-11(18)9-8(14-16-15-9)7-6(13)4-3-5(12)10(7)17/h3-4,17H,2H2,1H3,(H,14,15,16) |
| InChIKey | SOMNIOOCBPRYKA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |