C11H8BrClIN3O2 — CID 169401826
ethyl 5-(2-bromo-5-chloro-3-iodophenyl)-2H-triazole-4-carboxylate (PubChem CID 169401826) has the molecular formula C11H8BrClIN3O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is ethyl 5-(2-bromo-5-chloro-3-iodophenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-bromo-5-chloro-3-iodophenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401826 |
| Molecular Formula | C11H8BrClIN3O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 454.85 |
| IUPAC Name | ethyl 5-(2-bromo-5-chloro-3-iodophenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(Cl)cc(I)c1Br |
| InChI | InChI=1S/C11H8BrClIN3O2/c1-2-19-11(18)10-9(15-17-16-10)6-3-5(13)4-7(14)8(6)12/h3-4H,2H2,1H3,(H,15,16,17) |
| InChIKey | HGNMRPZTTQFAFX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|