C15H17Br2N3O4 — CID 169401059
ethyl 5-(2,3-dibromo-4,5-diethoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401059) has the molecular formula C15H17Br2N3O4 and a molecular weight of 463.13 g/mol. Its IUPAC name is ethyl 5-(2,3-dibromo-4,5-diethoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2,3-dibromo-4,5-diethoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401059 |
| Molecular Formula | C15H17Br2N3O4 |
| Molecular Weight | 463.13 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | ethyl 5-(2,3-dibromo-4,5-diethoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(OCC)c(OCC)c(Br)c1Br |
| InChI | InChI=1S/C15H17Br2N3O4/c1-4-22-9-7-8(10(16)11(17)14(9)23-5-2)12-13(19-20-18-12)15(21)24-6-3/h7H,4-6H2,1-3H3,(H,18,19,20) |
| InChIKey | AZXKCBZWDKAZSD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.13 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |