C15H16BrN3O4 — CID 169401037
ethyl 5-(2-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401037) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is ethyl 5-(2-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401037 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | ethyl 5-(2-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | C=CCOc1cc(Br)c(-c2n[nH]nc2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C15H16BrN3O4/c1-4-6-23-12-8-10(16)9(7-11(12)21-3)13-14(18-19-17-13)15(20)22-5-2/h4,7-8H,1,5-6H2,2-3H3,(H,17,18,19) |
| InChIKey | JLENCAHACFLCJX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|