C14H14BrN3O5 — CID 169401619
ethyl 5-(4-acetyloxy-2-bromo-5-methoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401619) has the molecular formula C14H14BrN3O5 and a molecular weight of 384.19 g/mol. Its IUPAC name is ethyl 5-(4-acetyloxy-2-bromo-5-methoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(4-acetyloxy-2-bromo-5-methoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401619 |
| Molecular Formula | C14H14BrN3O5 |
| Molecular Weight | 384.19 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | ethyl 5-(4-acetyloxy-2-bromo-5-methoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(OC)c(OC(C)=O)cc1Br |
| InChI | InChI=1S/C14H14BrN3O5/c1-4-22-14(20)13-12(16-18-17-13)8-5-10(21-3)11(6-9(8)15)23-7(2)19/h5-6H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | CNSHQFXNKHDZQP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|