C12H14BN3O5 — CID 169399234
[3-(5-ethoxycarbonyl-2H-triazol-4-yl)-4-methoxyphenyl]boronic acid (PubChem CID 169399234) has the molecular formula C12H14BN3O5 and a molecular weight of 291.07 g/mol. Its IUPAC name is [3-(5-ethoxycarbonyl-2H-triazol-4-yl)-4-methoxyphenyl]boronic acid.
| Compound Name | [3-(5-ethoxycarbonyl-2H-triazol-4-yl)-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 169399234 |
| Molecular Formula | C12H14BN3O5 |
| Molecular Weight | 291.07 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [3-(5-ethoxycarbonyl-2H-triazol-4-yl)-4-methoxyphenyl]boronic acid |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(B(O)O)ccc1OC |
| InChI | InChI=1S/C12H14BN3O5/c1-3-21-12(17)11-10(14-16-15-11)8-6-7(13(18)19)4-5-9(8)20-2/h4-6,18-19H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | DPVXSYKIQKULFX-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.07 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|