C10H9ClN4O2 — CID 169402198
5-(5-chloro-2-methoxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 169402198) has the molecular formula C10H9ClN4O2 and a molecular weight of 252.66 g/mol. Its IUPAC name is 5-(5-chloro-2-methoxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(5-chloro-2-methoxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402198 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 5-(5-chloro-2-methoxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1-c1n[nH]nc1C(N)=O |
| InChI | InChI=1S/C10H9ClN4O2/c1-17-7-3-2-5(11)4-6(7)8-9(10(12)16)14-15-13-8/h2-4H,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | ACKUFDPHXVJSKU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |