C16H11Cl2FN4O2 — CID 169403345
5-[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-2H-triazole-4-carboxamide (PubChem CID 169403345) has the molecular formula C16H11Cl2FN4O2 and a molecular weight of 381.19 g/mol. Its IUPAC name is 5-[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403345 |
| Molecular Formula | C16H11Cl2FN4O2 |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 5-[5-chloro-2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(Cl)ccc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H11Cl2FN4O2/c17-9-2-4-13(25-7-8-1-3-10(19)6-12(8)18)11(5-9)14-15(16(20)24)22-23-21-14/h1-6H,7H2,(H2,20,24)(H,21,22,23) |
| InChIKey | GHKGHNAKNIQZFX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |