C9H6ClFN4O2 — CID 169402286
5-(3-chloro-5-fluoro-2-hydroxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 169402286) has the molecular formula C9H6ClFN4O2 and a molecular weight of 256.62 g/mol. Its IUPAC name is 5-(3-chloro-5-fluoro-2-hydroxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3-chloro-5-fluoro-2-hydroxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402286 |
| Molecular Formula | C9H6ClFN4O2 |
| Molecular Weight | 256.62 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 5-(3-chloro-5-fluoro-2-hydroxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(F)cc(Cl)c1O |
| InChI | InChI=1S/C9H6ClFN4O2/c10-5-2-3(11)1-4(8(5)16)6-7(9(12)17)14-15-13-6/h1-2,16H,(H2,12,17)(H,13,14,15) |
| InChIKey | SRRCFKRAMQHXTF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.62 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |