C9H5Cl2FN4O — CID 169402307
5-(3,6-dichloro-2-fluorophenyl)-2H-triazole-4-carboxamide (PubChem CID 169402307) has the molecular formula C9H5Cl2FN4O and a molecular weight of 275.07 g/mol. Its IUPAC name is 5-(3,6-dichloro-2-fluorophenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3,6-dichloro-2-fluorophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402307 |
| Molecular Formula | C9H5Cl2FN4O |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 5-(3,6-dichloro-2-fluorophenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C9H5Cl2FN4O/c10-3-1-2-4(11)6(12)5(3)7-8(9(13)17)15-16-14-7/h1-2H,(H2,13,17)(H,14,15,16) |
| InChIKey | PTFPXZMSTDSLKM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|