C10H5ClF4N4O — CID 169404502
5-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169404502) has the molecular formula C10H5ClF4N4O and a molecular weight of 308.62 g/mol. Its IUPAC name is 5-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169404502 |
| Molecular Formula | C10H5ClF4N4O |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 5-[3-chloro-4-fluoro-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(Cl)c(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5ClF4N4O/c11-5-2-3(1-4(6(5)12)10(13,14)15)7-8(9(16)20)18-19-17-7/h1-2H,(H2,16,20)(H,17,18,19) |
| InChIKey | USEOCLJKGHZKGA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |