C14H14F3N5O — CID 169402955
5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402955) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is 5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402955 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1ccc(N2CCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3N5O/c15-14(16,17)9-7-8(11-12(13(18)23)20-21-19-11)3-4-10(9)22-5-1-2-6-22/h3-4,7H,1-2,5-6H2,(H2,18,23)(H,19,20,21) |
| InChIKey | LIKNKEPXXOFHSI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |