C10H5Cl2F3N4O — CID 169402340
5-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 169402340) has the molecular formula C10H5Cl2F3N4O and a molecular weight of 325.08 g/mol. Its IUPAC name is 5-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402340 |
| Molecular Formula | C10H5Cl2F3N4O |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 5-[2,6-dichloro-3-(trifluoromethyl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1c(Cl)ccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H5Cl2F3N4O/c11-4-2-1-3(10(13,14)15)6(12)5(4)7-8(9(16)20)18-19-17-7/h1-2H,(H2,16,20)(H,17,18,19) |
| InChIKey | QODBLZBBUBTKMI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |