C9H8N4O3 — CID 169402317
5-(3,5-dihydroxyphenyl)-2H-triazole-4-carboxamide (PubChem CID 169402317) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is 5-(3,5-dihydroxyphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3,5-dihydroxyphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402317 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 5-(3,5-dihydroxyphenyl)-2H-triazole-4-carboxamide |
| SMILES | NC(=O)c1n[nH]nc1-c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H8N4O3/c10-9(16)8-7(11-13-12-8)4-1-5(14)3-6(15)2-4/h1-3,14-15H,(H2,10,16)(H,11,12,13) |
| InChIKey | RRRGJUQPEAYSFY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |