C11H10N4O4 — CID 169402146
methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-hydroxybenzoate (PubChem CID 169402146) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-hydroxybenzoate.
| Compound Name | methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 169402146 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(-c2n[nH]nc2C(N)=O)ccc1O |
| InChI | InChI=1S/C11H10N4O4/c1-19-11(18)6-4-5(2-3-7(6)16)8-9(10(12)17)14-15-13-8/h2-4,16H,1H3,(H2,12,17)(H,13,14,15) |
| InChIKey | OROFHKPCXVLSSA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |