C10H9BrN4O — CID 169402148
5-(3-bromo-4-methylphenyl)-2H-triazole-4-carboxamide (PubChem CID 169402148) has the molecular formula C10H9BrN4O and a molecular weight of 281.11 g/mol. Its IUPAC name is 5-(3-bromo-4-methylphenyl)-2H-triazole-4-carboxamide.
| Compound Name | 5-(3-bromo-4-methylphenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169402148 |
| Molecular Formula | C10H9BrN4O |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 5-(3-bromo-4-methylphenyl)-2H-triazole-4-carboxamide |
| SMILES | Cc1ccc(-c2n[nH]nc2C(N)=O)cc1Br |
| InChI | InChI=1S/C10H9BrN4O/c1-5-2-3-6(4-7(5)11)8-9(10(12)16)14-15-13-8/h2-4H,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | JQBHCXFGWLBCND-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |