C12H12N4O4 — CID 169402123
methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxybenzoate (PubChem CID 169402123) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxybenzoate.
| Compound Name | methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 169402123 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(-c2n[nH]nc2C(N)=O)ccc1OC |
| InChI | InChI=1S/C12H12N4O4/c1-19-8-4-3-6(5-7(8)12(18)20-2)9-10(11(13)17)15-16-14-9/h3-5H,1-2H3,(H2,13,17)(H,14,15,16) |
| InChIKey | VINFFRFCZXKOGD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |