C18H16N4O4 — CID 169403763
[4-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenyl] 3-methylbenzoate (PubChem CID 169403763) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is [4-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenyl] 3-methylbenzoate.
| Compound Name | [4-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 169403763 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [4-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenyl] 3-methylbenzoate |
| SMILES | COc1cc(-c2n[nH]nc2C(N)=O)ccc1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C18H16N4O4/c1-10-4-3-5-12(8-10)18(24)26-13-7-6-11(9-14(13)25-2)15-16(17(19)23)21-22-20-15/h3-9H,1-2H3,(H2,19,23)(H,20,21,22) |
| InChIKey | FXXBWTQGHVOPLT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|