C17H13BrN4O4 — CID 169404005
[2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-methoxyphenyl] benzoate (PubChem CID 169404005) has the molecular formula C17H13BrN4O4 and a molecular weight of 417.22 g/mol. Its IUPAC name is [2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-methoxyphenyl] benzoate.
| Compound Name | [2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 169404005 |
| Molecular Formula | C17H13BrN4O4 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | [2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-methoxyphenyl] benzoate |
| SMILES | COc1cc(-c2n[nH]nc2C(N)=O)cc(Br)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13BrN4O4/c1-25-12-8-10(13-14(16(19)23)21-22-20-13)7-11(18)15(12)26-17(24)9-5-3-2-4-6-9/h2-8H,1H3,(H2,19,23)(H,20,21,22) |
| InChIKey | PDCKVRIOEVQWNX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|