C18H15BrN4O4 — CID 169404014
[2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-ethoxyphenyl] benzoate (PubChem CID 169404014) has the molecular formula C18H15BrN4O4 and a molecular weight of 431.25 g/mol. Its IUPAC name is [2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-ethoxyphenyl] benzoate.
| Compound Name | [2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 169404014 |
| Molecular Formula | C18H15BrN4O4 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | [2-bromo-4-(5-carbamoyl-2H-triazol-4-yl)-6-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(-c2n[nH]nc2C(N)=O)cc(Br)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15BrN4O4/c1-2-26-13-9-11(14-15(17(20)24)22-23-21-14)8-12(19)16(13)27-18(25)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H2,20,24)(H,21,22,23) |
| InChIKey | VQAOOWXVQYLRMT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|